C19H27N3O5 — CID 70034589
[(2R)-1-[4-[3-(4-acetylphenoxy)propyl]piperazin-1-yl]-1-oxopropan-2-yl]carbamic acid (PubChem CID 70034589) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is [(2R)-1-[4-[3-(4-acetylphenoxy)propyl]piperazin-1-yl]-1-oxopropan-2-yl]carbamic acid.
| Compound Name | [(2R)-1-[4-[3-(4-acetylphenoxy)propyl]piperazin-1-yl]-1-oxopropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 70034589 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | [(2R)-1-[4-[3-(4-acetylphenoxy)propyl]piperazin-1-yl]-1-oxopropan-2-yl]carbamic acid |
| SMILES | CC(=O)c1ccc(OCCCN2CCN(C(=O)[C@@H](C)NC(=O)O)CC2)cc1 |
| InChI | InChI=1S/C19H27N3O5/c1-14(20-19(25)26)18(24)22-11-9-21(10-12-22)8-3-13-27-17-6-4-16(5-7-17)15(2)23/h4-7,14,20H,3,8-13H2,1-2H3,(H,25,26)/t14-/m1/s1 |
| InChIKey | ITLDXTZBPNFRKW-CQSZACIVSA-N |
| XLogP | 1.46 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|