C26H41N3O5 — CID 70035075
[(2S)-1-[4-[3-(4-hexanoylphenoxy)propyl]piperazin-1-yl]-4-methyl-1-oxopentan-2-yl]carbamic acid (PubChem CID 70035075) has the molecular formula C26H41N3O5 and a molecular weight of 475.63 g/mol. Its IUPAC name is [(2S)-1-[4-[3-(4-hexanoylphenoxy)propyl]piperazin-1-yl]-4-methyl-1-oxopentan-2-yl]carbamic acid.
| Compound Name | [(2S)-1-[4-[3-(4-hexanoylphenoxy)propyl]piperazin-1-yl]-4-methyl-1-oxopentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 70035075 |
| Molecular Formula | C26H41N3O5 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.30 |
| IUPAC Name | [(2S)-1-[4-[3-(4-hexanoylphenoxy)propyl]piperazin-1-yl]-4-methyl-1-oxopentan-2-yl]carbamic acid |
| SMILES | CCCCCC(=O)c1ccc(OCCCN2CCN(C(=O)[C@H](CC(C)C)NC(=O)O)CC2)cc1 |
| InChI | InChI=1S/C26H41N3O5/c1-4-5-6-8-24(30)21-9-11-22(12-10-21)34-18-7-13-28-14-16-29(17-15-28)25(31)23(19-20(2)3)27-26(32)33/h9-12,20,23,27H,4-8,13-19H2,1-3H3,(H,32,33)/t23-/m0/s1 |
| InChIKey | OJSJXDNXPPTXFC-QHCPKHFHSA-N |
| XLogP | 4.05 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|