C26H46N2O2 — CID 143299998
N-butan-2-yl-4-(3-piperidin-1-ylpropoxy)benzamide;heptane (PubChem CID 143299998) has the molecular formula C26H46N2O2 and a molecular weight of 418.67 g/mol. Its IUPAC name is N-butan-2-yl-4-(3-piperidin-1-ylpropoxy)benzamide;heptane.
| Compound Name | N-butan-2-yl-4-(3-piperidin-1-ylpropoxy)benzamide;heptane |
|---|---|
| PubChem CID | 143299998 |
| Molecular Formula | C26H46N2O2 |
| Molecular Weight | 418.67 g/mol |
| Exact Mass | 418.36 |
| IUPAC Name | N-butan-2-yl-4-(3-piperidin-1-ylpropoxy)benzamide;heptane |
| SMILES | CCC(C)NC(=O)c1ccc(OCCCN2CCCCC2)cc1.CCCCCCC |
| InChI | InChI=1S/C19H30N2O2.C7H16/c1-3-16(2)20-19(22)17-8-10-18(11-9-17)23-15-7-14-21-12-5-4-6-13-21;1-3-5-7-6-4-2/h8-11,16H,3-7,12-15H2,1-2H3,(H,20,22);3-7H2,1-2H3 |
| InChIKey | FURMWKMAQOGUBX-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.67 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|