C24H32N2O3 — CID 11950190
N-(1-hydroxy-3-phenylpropan-2-yl)-4-(3-piperidin-1-ylpropoxy)benzamide (PubChem CID 11950190) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is N-(1-hydroxy-3-phenylpropan-2-yl)-4-(3-piperidin-1-ylpropoxy)benzamide.
| Compound Name | N-(1-hydroxy-3-phenylpropan-2-yl)-4-(3-piperidin-1-ylpropoxy)benzamide |
|---|---|
| PubChem CID | 11950190 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | N-(1-hydroxy-3-phenylpropan-2-yl)-4-(3-piperidin-1-ylpropoxy)benzamide |
| SMILES | O=C(NC(CO)Cc1ccccc1)c1ccc(OCCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C24H32N2O3/c27-19-22(18-20-8-3-1-4-9-20)25-24(28)21-10-12-23(13-11-21)29-17-7-16-26-14-5-2-6-15-26/h1,3-4,8-13,22,27H,2,5-7,14-19H2,(H,25,28) |
| InChIKey | ZSSKCWZNBLFDTC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|