C26H32FN3O2 — CID 22718376
4-[1-[4-[2-(4-fluorophenoxy)ethyl]piperazin-1-yl]-1-oxohexan-2-yl]-2-methylbenzonitrile (PubChem CID 22718376) has the molecular formula C26H32FN3O2 and a molecular weight of 437.56 g/mol. Its IUPAC name is 4-[1-[4-[2-(4-fluorophenoxy)ethyl]piperazin-1-yl]-1-oxohexan-2-yl]-2-methylbenzonitrile.
| Compound Name | 4-[1-[4-[2-(4-fluorophenoxy)ethyl]piperazin-1-yl]-1-oxohexan-2-yl]-2-methylbenzonitrile |
|---|---|
| PubChem CID | 22718376 |
| Molecular Formula | C26H32FN3O2 |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 4-[1-[4-[2-(4-fluorophenoxy)ethyl]piperazin-1-yl]-1-oxohexan-2-yl]-2-methylbenzonitrile |
| SMILES | CCCCC(C(=O)N1CCN(CCOc2ccc(F)cc2)CC1)c1ccc(C#N)c(C)c1 |
| InChI | InChI=1S/C26H32FN3O2/c1-3-4-5-25(21-6-7-22(19-28)20(2)18-21)26(31)30-14-12-29(13-15-30)16-17-32-24-10-8-23(27)9-11-24/h6-11,18,25H,3-5,12-17H2,1-2H3 |
| InChIKey | HINGWULBRXSBPB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |