C26H33F2N3O — CID 22718364
4-[1-[4-[2-(3,4-difluorophenoxy)ethyl]piperazin-1-yl]hexyl]-2-methylbenzonitrile (PubChem CID 22718364) has the molecular formula C26H33F2N3O and a molecular weight of 441.57 g/mol. Its IUPAC name is 4-[1-[4-[2-(3,4-difluorophenoxy)ethyl]piperazin-1-yl]hexyl]-2-methylbenzonitrile.
| Compound Name | 4-[1-[4-[2-(3,4-difluorophenoxy)ethyl]piperazin-1-yl]hexyl]-2-methylbenzonitrile |
|---|---|
| PubChem CID | 22718364 |
| Molecular Formula | C26H33F2N3O |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | 4-[1-[4-[2-(3,4-difluorophenoxy)ethyl]piperazin-1-yl]hexyl]-2-methylbenzonitrile |
| SMILES | CCCCCC(c1ccc(C#N)c(C)c1)N1CCN(CCOc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C26H33F2N3O/c1-3-4-5-6-26(21-7-8-22(19-29)20(2)17-21)31-13-11-30(12-14-31)15-16-32-23-9-10-24(27)25(28)18-23/h7-10,17-18,26H,3-6,11-16H2,1-2H3 |
| InChIKey | AFTJFVXAOMOFKE-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 39.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|