C28H36N4 — CID 22393832
2-methyl-4-[1-[4-[(1-methylindol-2-yl)methyl]piperazin-1-yl]hexyl]benzonitrile (PubChem CID 22393832) has the molecular formula C28H36N4 and a molecular weight of 428.62 g/mol. Its IUPAC name is 2-methyl-4-[1-[4-[(1-methylindol-2-yl)methyl]piperazin-1-yl]hexyl]benzonitrile.
| Compound Name | 2-methyl-4-[1-[4-[(1-methylindol-2-yl)methyl]piperazin-1-yl]hexyl]benzonitrile |
|---|---|
| PubChem CID | 22393832 |
| Molecular Formula | C28H36N4 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | 2-methyl-4-[1-[4-[(1-methylindol-2-yl)methyl]piperazin-1-yl]hexyl]benzonitrile |
| SMILES | CCCCCC(c1ccc(C#N)c(C)c1)N1CCN(Cc2cc3ccccc3n2C)CC1 |
| InChI | InChI=1S/C28H36N4/c1-4-5-6-11-28(24-12-13-25(20-29)22(2)18-24)32-16-14-31(15-17-32)21-26-19-23-9-7-8-10-27(23)30(26)3/h7-10,12-13,18-19,28H,4-6,11,14-17,21H2,1-3H3 |
| InChIKey | FJNBRURFRKJDFJ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 35.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|