C21H32BrN3O2 — CID 170453843
tert-butyl N-[1-[(4-bromo-2-pyrrolidin-1-ylphenyl)methyl]piperidin-4-yl]carbamate (PubChem CID 170453843) has the molecular formula C21H32BrN3O2 and a molecular weight of 438.41 g/mol. Its IUPAC name is tert-butyl N-[1-[(4-bromo-2-pyrrolidin-1-ylphenyl)methyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(4-bromo-2-pyrrolidin-1-ylphenyl)methyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 170453843 |
| Molecular Formula | C21H32BrN3O2 |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | tert-butyl N-[1-[(4-bromo-2-pyrrolidin-1-ylphenyl)methyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(Cc2ccc(Br)cc2N2CCCC2)CC1 |
| InChI | InChI=1S/C21H32BrN3O2/c1-21(2,3)27-20(26)23-18-8-12-24(13-9-18)15-16-6-7-17(22)14-19(16)25-10-4-5-11-25/h6-7,14,18H,4-5,8-13,15H2,1-3H3,(H,23,26) |
| InChIKey | FQEJNVCMQIOLCO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |