C30H42N4O8S2 — CID 10189773
tert-butyl N-[1-[(6-amino-2-pyridinyl)methyl]piperidin-4-yl]carbamate;bis(4-methylbenzenesulfonic acid) (PubChem CID 10189773) has the molecular formula C30H42N4O8S2 and a molecular weight of 650.82 g/mol. Its IUPAC name is tert-butyl N-[1-[(6-amino-2-pyridinyl)methyl]piperidin-4-yl]carbamate;bis(4-methylbenzenesulfonic acid).
| Compound Name | tert-butyl N-[1-[(6-amino-2-pyridinyl)methyl]piperidin-4-yl]carbamate;bis(4-methylbenzenesulfonic acid) |
|---|---|
| PubChem CID | 10189773 |
| Molecular Formula | C30H42N4O8S2 |
| Molecular Weight | 650.82 g/mol |
| Exact Mass | 650.24 |
| IUPAC Name | tert-butyl N-[1-[(6-amino-2-pyridinyl)methyl]piperidin-4-yl]carbamate;bis(4-methylbenzenesulfonic acid) |
| SMILES | CC(C)(C)OC(=O)NC1CCN(Cc2cccc(N)n2)CC1.Cc1ccc(S(=O)(=O)O)cc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C16H26N4O2.2C7H8O3S/c1-16(2,3)22-15(21)19-12-7-9-20(10-8-12)11-13-5-4-6-14(17)18-13;2*1-6-2-4-7(5-3-6)11(8,9)10/h4-6,12H,7-11H2,1-3H3,(H2,17,18)(H,19,21);2*2-5H,1H3,(H,8,9,10) |
| InChIKey | ODPFVEZNPUDFHI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 189.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.82 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|