C12H19N5O4 — CID 116735124
2-amino-3-[1-[2-(oxan-4-ylamino)-2-oxoethyl]triazol-4-yl]propanoic acid (PubChem CID 116735124) has the molecular formula C12H19N5O4 and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-amino-3-[1-[2-(oxan-4-ylamino)-2-oxoethyl]triazol-4-yl]propanoic acid.
| Compound Name | 2-amino-3-[1-[2-(oxan-4-ylamino)-2-oxoethyl]triazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 116735124 |
| Molecular Formula | C12H19N5O4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 2-amino-3-[1-[2-(oxan-4-ylamino)-2-oxoethyl]triazol-4-yl]propanoic acid |
| SMILES | NC(Cc1cn(CC(=O)NC2CCOCC2)nn1)C(=O)O |
| InChI | InChI=1S/C12H19N5O4/c13-10(12(19)20)5-9-6-17(16-15-9)7-11(18)14-8-1-3-21-4-2-8/h6,8,10H,1-5,7,13H2,(H,14,18)(H,19,20) |
| InChIKey | GCKURFJQIPAWNA-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 132.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |