C16H21N5O3 — CID 119333449
2-amino-N-[1-[2-(2-methoxyethylamino)-2-oxoethyl]pyrazol-4-yl]-2-phenylacetamide (PubChem CID 119333449) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is 2-amino-N-[1-[2-(2-methoxyethylamino)-2-oxoethyl]pyrazol-4-yl]-2-phenylacetamide.
| Compound Name | 2-amino-N-[1-[2-(2-methoxyethylamino)-2-oxoethyl]pyrazol-4-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 119333449 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 2-amino-N-[1-[2-(2-methoxyethylamino)-2-oxoethyl]pyrazol-4-yl]-2-phenylacetamide |
| SMILES | COCCNC(=O)Cn1cc(NC(=O)C(N)c2ccccc2)cn1 |
| InChI | InChI=1S/C16H21N5O3/c1-24-8-7-18-14(22)11-21-10-13(9-19-21)20-16(23)15(17)12-5-3-2-4-6-12/h2-6,9-10,15H,7-8,11,17H2,1H3,(H,18,22)(H,20,23) |
| InChIKey | ZHSGOHKTZMPTFE-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|