C17H24ClN5O3 — CID 120611234
3-(2-aminophenyl)-N-[1-[2-(2-methoxyethylamino)-2-oxoethyl]pyrazol-4-yl]propanamide;hydrochloride (PubChem CID 120611234) has the molecular formula C17H24ClN5O3 and a molecular weight of 381.86 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[1-[2-(2-methoxyethylamino)-2-oxoethyl]pyrazol-4-yl]propanamide;hydrochloride.
| Compound Name | 3-(2-aminophenyl)-N-[1-[2-(2-methoxyethylamino)-2-oxoethyl]pyrazol-4-yl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 120611234 |
| Molecular Formula | C17H24ClN5O3 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 3-(2-aminophenyl)-N-[1-[2-(2-methoxyethylamino)-2-oxoethyl]pyrazol-4-yl]propanamide;hydrochloride |
| SMILES | COCCNC(=O)Cn1cc(NC(=O)CCc2ccccc2N)cn1.Cl |
| InChI | InChI=1S/C17H23N5O3.ClH/c1-25-9-8-19-17(24)12-22-11-14(10-20-22)21-16(23)7-6-13-4-2-3-5-15(13)18;/h2-5,10-11H,6-9,12,18H2,1H3,(H,19,24)(H,21,23);1H |
| InChIKey | LSIWGWDFYQNELA-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|