C10H13N5O2 — CID 81257970
N-[1-(2-methoxyethyl)pyrazol-4-yl]imidazole-1-carboxamide (PubChem CID 81257970) has the molecular formula C10H13N5O2 and a molecular weight of 235.25 g/mol. Its IUPAC name is N-[1-(2-methoxyethyl)pyrazol-4-yl]imidazole-1-carboxamide.
| Compound Name | N-[1-(2-methoxyethyl)pyrazol-4-yl]imidazole-1-carboxamide |
|---|---|
| PubChem CID | 81257970 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | N-[1-(2-methoxyethyl)pyrazol-4-yl]imidazole-1-carboxamide |
| SMILES | COCCn1cc(NC(=O)n2ccnc2)cn1 |
| InChI | InChI=1S/C10H13N5O2/c1-17-5-4-15-7-9(6-12-15)13-10(16)14-3-2-11-8-14/h2-3,6-8H,4-5H2,1H3,(H,13,16) |
| InChIKey | KEVFLGVTTHDWBM-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |