C18H17ClN4OS — CID 19445501
1-[1-[(3-chlorophenoxy)methyl]pyrazol-4-yl]-3-(2-methylphenyl)thiourea (PubChem CID 19445501) has the molecular formula C18H17ClN4OS and a molecular weight of 372.88 g/mol. Its IUPAC name is 1-[1-[(3-chlorophenoxy)methyl]pyrazol-4-yl]-3-(2-methylphenyl)thiourea.
| Compound Name | 1-[1-[(3-chlorophenoxy)methyl]pyrazol-4-yl]-3-(2-methylphenyl)thiourea |
|---|---|
| PubChem CID | 19445501 |
| Molecular Formula | C18H17ClN4OS |
| Molecular Weight | 372.88 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 1-[1-[(3-chlorophenoxy)methyl]pyrazol-4-yl]-3-(2-methylphenyl)thiourea |
| SMILES | Cc1ccccc1NC(=S)Nc1cnn(COc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C18H17ClN4OS/c1-13-5-2-3-8-17(13)22-18(25)21-15-10-20-23(11-15)12-24-16-7-4-6-14(19)9-16/h2-11H,12H2,1H3,(H2,21,22,25) |
| InChIKey | DYTPXEPJJHGKGK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.88 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|