C21H24N4OS — CID 19344791
1-(2,3-dimethylphenyl)-3-[1-[(4-ethylphenoxy)methyl]pyrazol-4-yl]thiourea (PubChem CID 19344791) has the molecular formula C21H24N4OS and a molecular weight of 380.52 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-[1-[(4-ethylphenoxy)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-[1-[(4-ethylphenoxy)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19344791 |
| Molecular Formula | C21H24N4OS |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-[1-[(4-ethylphenoxy)methyl]pyrazol-4-yl]thiourea |
| SMILES | CCc1ccc(OCn2cc(NC(=S)Nc3cccc(C)c3C)cn2)cc1 |
| InChI | InChI=1S/C21H24N4OS/c1-4-17-8-10-19(11-9-17)26-14-25-13-18(12-22-25)23-21(27)24-20-7-5-6-15(2)16(20)3/h5-13H,4,14H2,1-3H3,(H2,23,24,27) |
| InChIKey | ZXSNHXARQCBPJG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|