C15H19ClN4OS — CID 19445498
1-butan-2-yl-3-[1-[(3-chlorophenoxy)methyl]pyrazol-4-yl]thiourea (PubChem CID 19445498) has the molecular formula C15H19ClN4OS and a molecular weight of 338.86 g/mol. Its IUPAC name is 1-butan-2-yl-3-[1-[(3-chlorophenoxy)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-butan-2-yl-3-[1-[(3-chlorophenoxy)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19445498 |
| Molecular Formula | C15H19ClN4OS |
| Molecular Weight | 338.86 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 1-butan-2-yl-3-[1-[(3-chlorophenoxy)methyl]pyrazol-4-yl]thiourea |
| SMILES | CCC(C)NC(=S)Nc1cnn(COc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C15H19ClN4OS/c1-3-11(2)18-15(22)19-13-8-17-20(9-13)10-21-14-6-4-5-12(16)7-14/h4-9,11H,3,10H2,1-2H3,(H2,18,19,22) |
| InChIKey | URTZWGMFMLAAQV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.86 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|