C21H14BrClF4N6S — CID 19343667
1-[4-bromo-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]thiourea (PubChem CID 19343667) has the molecular formula C21H14BrClF4N6S and a molecular weight of 573.80 g/mol. Its IUPAC name is 1-[4-bromo-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-[4-bromo-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19343667 |
| Molecular Formula | C21H14BrClF4N6S |
| Molecular Weight | 573.80 g/mol |
| Exact Mass | 571.98 |
| IUPAC Name | 1-[4-bromo-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]thiourea |
| SMILES | Fc1cc(F)c(Cn2cc(NC(=S)Nc3nn(Cc4ccccc4Cl)cc3Br)cn2)c(F)c1F |
| InChI | InChI=1S/C21H14BrClF4N6S/c22-14-10-33(7-11-3-1-2-4-15(11)23)31-20(14)30-21(34)29-12-6-28-32(8-12)9-13-16(24)5-17(25)19(27)18(13)26/h1-6,8,10H,7,9H2,(H2,29,30,31,34) |
| InChIKey | KNBGXPRAJHTSMD-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.80 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|