C18H16ClFN4OS — CID 19343827
1-(3-chloro-4-fluorophenyl)-3-[1-[(3-methoxyphenyl)methyl]pyrazol-4-yl]thiourea (PubChem CID 19343827) has the molecular formula C18H16ClFN4OS and a molecular weight of 390.87 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[1-[(3-methoxyphenyl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[1-[(3-methoxyphenyl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19343827 |
| Molecular Formula | C18H16ClFN4OS |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[1-[(3-methoxyphenyl)methyl]pyrazol-4-yl]thiourea |
| SMILES | COc1cccc(Cn2cc(NC(=S)Nc3ccc(F)c(Cl)c3)cn2)c1 |
| InChI | InChI=1S/C18H16ClFN4OS/c1-25-15-4-2-3-12(7-15)10-24-11-14(9-21-24)23-18(26)22-13-5-6-17(20)16(19)8-13/h2-9,11H,10H2,1H3,(H2,22,23,26) |
| InChIKey | GWBNCGXFOMRPNW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|