C19H19ClN4O2 — CID 2956043
1-(3-chloro-4-methylphenyl)-3-[1-[(3-methoxyphenyl)methyl]pyrazol-4-yl]urea (PubChem CID 2956043) has the molecular formula C19H19ClN4O2 and a molecular weight of 370.84 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[1-[(3-methoxyphenyl)methyl]pyrazol-4-yl]urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[1-[(3-methoxyphenyl)methyl]pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 2956043 |
| Molecular Formula | C19H19ClN4O2 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[1-[(3-methoxyphenyl)methyl]pyrazol-4-yl]urea |
| SMILES | COc1cccc(Cn2cc(NC(=O)Nc3ccc(C)c(Cl)c3)cn2)c1 |
| InChI | InChI=1S/C19H19ClN4O2/c1-13-6-7-15(9-18(13)20)22-19(25)23-16-10-21-24(12-16)11-14-4-3-5-17(8-14)26-2/h3-10,12H,11H2,1-2H3,(H2,22,23,25) |
| InChIKey | CZZDKJJXOXGSPM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |