C20H28FN5O — CID 118792353
1-[2-(azepan-1-yl)ethyl]-3-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-1-methylurea (PubChem CID 118792353) has the molecular formula C20H28FN5O and a molecular weight of 373.48 g/mol. Its IUPAC name is 1-[2-(azepan-1-yl)ethyl]-3-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-1-methylurea.
| Compound Name | 1-[2-(azepan-1-yl)ethyl]-3-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-1-methylurea |
|---|---|
| PubChem CID | 118792353 |
| Molecular Formula | C20H28FN5O |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | 1-[2-(azepan-1-yl)ethyl]-3-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-1-methylurea |
| SMILES | CN(CCN1CCCCCC1)C(=O)Nc1cnn(Cc2cccc(F)c2)c1 |
| InChI | InChI=1S/C20H28FN5O/c1-24(11-12-25-9-4-2-3-5-10-25)20(27)23-19-14-22-26(16-19)15-17-7-6-8-18(21)13-17/h6-8,13-14,16H,2-5,9-12,15H2,1H3,(H,23,27) |
| InChIKey | VQFZMEOWYFUCPT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |