C22H20ClFN6S — CID 19403479
1-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-3-[1-[(2-fluorophenyl)methyl]-5-methylpyrazol-3-yl]thiourea (PubChem CID 19403479) has the molecular formula C22H20ClFN6S and a molecular weight of 454.96 g/mol. Its IUPAC name is 1-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-3-[1-[(2-fluorophenyl)methyl]-5-methylpyrazol-3-yl]thiourea.
| Compound Name | 1-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-3-[1-[(2-fluorophenyl)methyl]-5-methylpyrazol-3-yl]thiourea |
|---|---|
| PubChem CID | 19403479 |
| Molecular Formula | C22H20ClFN6S |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 1-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-3-[1-[(2-fluorophenyl)methyl]-5-methylpyrazol-3-yl]thiourea |
| SMILES | Cc1cc(NC(=S)Nc2cnn(Cc3cccc(Cl)c3)c2)nn1Cc1ccccc1F |
| InChI | InChI=1S/C22H20ClFN6S/c1-15-9-21(28-30(15)13-17-6-2-3-8-20(17)24)27-22(31)26-19-11-25-29(14-19)12-16-5-4-7-18(23)10-16/h2-11,14H,12-13H2,1H3,(H2,26,27,28,31) |
| InChIKey | ULXLQLUJHVFMQW-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|