C23H21Cl2FN6S — CID 19395237
1-[1-[(2,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]thiourea (PubChem CID 19395237) has the molecular formula C23H21Cl2FN6S and a molecular weight of 503.43 g/mol. Its IUPAC name is 1-[1-[(2,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]thiourea.
| Compound Name | 1-[1-[(2,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]thiourea |
|---|---|
| PubChem CID | 19395237 |
| Molecular Formula | C23H21Cl2FN6S |
| Molecular Weight | 503.43 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | 1-[1-[(2,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]thiourea |
| SMILES | Cc1nn(Cc2ccc(Cl)cc2Cl)c(C)c1NC(=S)Nc1ccn(Cc2ccccc2F)n1 |
| InChI | InChI=1S/C23H21Cl2FN6S/c1-14-22(15(2)32(29-14)13-16-7-8-18(24)11-19(16)25)28-23(33)27-21-9-10-31(30-21)12-17-5-3-4-6-20(17)26/h3-11H,12-13H2,1-2H3,(H2,27,28,30,33) |
| InChIKey | JMRBEDVXTYXTHR-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.43 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|