C20H20N4O2 — CID 6200239
N-[(Z)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-4-methoxybenzamide (PubChem CID 6200239) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is N-[(Z)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-4-methoxybenzamide.
| Compound Name | N-[(Z)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-4-methoxybenzamide |
|---|---|
| PubChem CID | 6200239 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-[(Z)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N/N=C\c2c(C)nn(-c3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C20H20N4O2/c1-14-19(15(2)24(23-14)17-7-5-4-6-8-17)13-21-22-20(25)16-9-11-18(26-3)12-10-16/h4-13H,1-3H3,(H,22,25)/b21-13- |
| InChIKey | FCPPXJXJZIFRCO-BKUYFWCQSA-N |
| XLogP | 3.26 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|