C24H24N6O2 — CID 6154939
3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[(Z)-(2-ethoxyphenyl)methylideneamino]-1H-pyrazole-5-carboxamide (PubChem CID 6154939) has the molecular formula C24H24N6O2 and a molecular weight of 428.50 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[(Z)-(2-ethoxyphenyl)methylideneamino]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[(Z)-(2-ethoxyphenyl)methylideneamino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 6154939 |
| Molecular Formula | C24H24N6O2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[(Z)-(2-ethoxyphenyl)methylideneamino]-1H-pyrazole-5-carboxamide |
| SMILES | CCOc1ccccc1/C=N\NC(=O)c1cc(-c2c(C)nn(-c3ccccc3)c2C)n[nH]1 |
| InChI | InChI=1S/C24H24N6O2/c1-4-32-22-13-9-8-10-18(22)15-25-28-24(31)21-14-20(26-27-21)23-16(2)29-30(17(23)3)19-11-6-5-7-12-19/h5-15H,4H2,1-3H3,(H,26,27)(H,28,31)/b25-15- |
| InChIKey | FYBPIDCETPUPJF-MYYYXRDXSA-N |
| XLogP | 4.04 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|