C36H32N4O4P2 — CID 4090438
2-diphenylphosphoryl-N-[[3-[[(2-diphenylphosphorylacetyl)hydrazinylidene]methyl]phenyl]methylideneamino]acetamide (PubChem CID 4090438) has the molecular formula C36H32N4O4P2 and a molecular weight of 646.62 g/mol. Its IUPAC name is 2-diphenylphosphoryl-N-[[3-[[(2-diphenylphosphorylacetyl)hydrazinylidene]methyl]phenyl]methylideneamino]acetamide.
| Compound Name | 2-diphenylphosphoryl-N-[[3-[[(2-diphenylphosphorylacetyl)hydrazinylidene]methyl]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 4090438 |
| Molecular Formula | C36H32N4O4P2 |
| Molecular Weight | 646.62 g/mol |
| Exact Mass | 646.19 |
| IUPAC Name | 2-diphenylphosphoryl-N-[[3-[[(2-diphenylphosphorylacetyl)hydrazinylidene]methyl]phenyl]methylideneamino]acetamide |
| SMILES | O=C(CP(=O)(c1ccccc1)c1ccccc1)NN=Cc1cccc(C=NNC(=O)CP(=O)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C36H32N4O4P2/c41-35(27-45(43,31-16-5-1-6-17-31)32-18-7-2-8-19-32)39-37-25-29-14-13-15-30(24-29)26-38-40-36(42)28-46(44,33-20-9-3-10-21-33)34-22-11-4-12-23-34/h1-26H,27-28H2,(H,39,41)(H,40,42) |
| InChIKey | JRBCHQBVNLISSD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 117.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.62 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|