C28H26N4O4 — CID 75083253
N-[(3-ethenylphenyl)methylideneamino]-2-[4-[2-[2-[(3-ethenylphenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenoxy]acetamide (PubChem CID 75083253) has the molecular formula C28H26N4O4 and a molecular weight of 482.54 g/mol. Its IUPAC name is N-[(3-ethenylphenyl)methylideneamino]-2-[4-[2-[2-[(3-ethenylphenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenoxy]acetamide.
| Compound Name | N-[(3-ethenylphenyl)methylideneamino]-2-[4-[2-[2-[(3-ethenylphenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenoxy]acetamide |
|---|---|
| PubChem CID | 75083253 |
| Molecular Formula | C28H26N4O4 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | N-[(3-ethenylphenyl)methylideneamino]-2-[4-[2-[2-[(3-ethenylphenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenoxy]acetamide |
| SMILES | C=Cc1cccc(C=NNC(=O)COc2ccc(OCC(=O)NN=Cc3cccc(C=C)c3)cc2)c1 |
| InChI | InChI=1S/C28H26N4O4/c1-3-21-7-5-9-23(15-21)17-29-31-27(33)19-35-25-11-13-26(14-12-25)36-20-28(34)32-30-18-24-10-6-8-22(4-2)16-24/h3-18H,1-2,19-20H2,(H,31,33)(H,32,34) |
| InChIKey | VIMPKXWCLWUSKI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|