C34H32N4O4 — CID 172923050
2-[4-[1-[4-[2-[(2E)-2-[(3-ethenylphenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-1-phenylethyl]phenoxy]-N-(methylideneamino)acetamide (PubChem CID 172923050) has the molecular formula C34H32N4O4 and a molecular weight of 560.65 g/mol. Its IUPAC name is 2-[4-[1-[4-[2-[(2E)-2-[(3-ethenylphenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-1-phenylethyl]phenoxy]-N-(methylideneamino)acetamide.
| Compound Name | 2-[4-[1-[4-[2-[(2E)-2-[(3-ethenylphenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-1-phenylethyl]phenoxy]-N-(methylideneamino)acetamide |
|---|---|
| PubChem CID | 172923050 |
| Molecular Formula | C34H32N4O4 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | 2-[4-[1-[4-[2-[(2E)-2-[(3-ethenylphenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-1-phenylethyl]phenoxy]-N-(methylideneamino)acetamide |
| SMILES | C=Cc1cccc(/C=N/NC(=O)COc2ccc(C(C)(c3ccccc3)c3ccc(OCC(=O)NN=C)cc3)cc2)c1 |
| InChI | InChI=1S/C34H32N4O4/c1-4-25-9-8-10-26(21-25)22-36-38-33(40)24-42-31-19-15-29(16-20-31)34(2,27-11-6-5-7-12-27)28-13-17-30(18-14-28)41-23-32(39)37-35-3/h4-22H,1,3,23-24H2,2H3,(H,37,39)(H,38,40)/b36-22+ |
| InChIKey | GOVSXIUUTLUADA-HPNXWYHWSA-N |
| XLogP | 5.32 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|