C24H20ClN6O7P — CID 6112599
2-[(4-chlorophenyl)-[2-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]phosphoryl]-N-[(Z)-(3-nitrophenyl)methylideneamino]acetamide (PubChem CID 6112599) has the molecular formula C24H20ClN6O7P and a molecular weight of 570.89 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)-[2-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]phosphoryl]-N-[(Z)-(3-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-[(4-chlorophenyl)-[2-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]phosphoryl]-N-[(Z)-(3-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6112599 |
| Molecular Formula | C24H20ClN6O7P |
| Molecular Weight | 570.89 g/mol |
| Exact Mass | 570.08 |
| IUPAC Name | 2-[(4-chlorophenyl)-[2-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]phosphoryl]-N-[(Z)-(3-nitrophenyl)methylideneamino]acetamide |
| SMILES | O=C(CP(=O)(CC(=O)N/N=C\c1cccc([N+](=O)[O-])c1)c1ccc(Cl)cc1)N/N=C\c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H20ClN6O7P/c25-19-7-9-22(10-8-19)39(38,15-23(32)28-26-13-17-3-1-5-20(11-17)30(34)35)16-24(33)29-27-14-18-4-2-6-21(12-18)31(36)37/h1-14H,15-16H2,(H,28,32)(H,29,33)/b26-13-,27-14- |
| InChIKey | KMYIAMYTHPAPGZ-IFADSCNNSA-N |
| XLogP | 3.45 |
| TPSA | 186.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.89 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|