C14H12Br2N3O2+ — CID 136904650
N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-pyridin-1-ium-1-ylacetamide (PubChem CID 136904650) has the molecular formula C14H12Br2N3O2+ and a molecular weight of 414.08 g/mol. Its IUPAC name is N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-pyridin-1-ium-1-ylacetamide.
| Compound Name | N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-pyridin-1-ium-1-ylacetamide |
|---|---|
| PubChem CID | 136904650 |
| Molecular Formula | C14H12Br2N3O2+ |
| Molecular Weight | 414.08 g/mol |
| Exact Mass | 411.93 |
| IUPAC Name | N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-pyridin-1-ium-1-ylacetamide |
| SMILES | O=C(C[n+]1ccccc1)N/N=C\c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C14H11Br2N3O2/c15-11-6-10(14(21)12(16)7-11)8-17-18-13(20)9-19-4-2-1-3-5-19/h1-8H,9H2,(H-,17,18,20,21)/p+1 |
| InChIKey | CNJVDFJNNWYBDK-UHFFFAOYSA-O |
| XLogP | 2.36 |
| TPSA | 65.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.08 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|