C16H12Br2N2O4 — CID 137127270
2-(1,3-benzodioxol-5-yl)-N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 137127270) has the molecular formula C16H12Br2N2O4 and a molecular weight of 456.09 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 137127270 |
| Molecular Formula | C16H12Br2N2O4 |
| Molecular Weight | 456.09 g/mol |
| Exact Mass | 453.92 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | O=C(Cc1ccc2c(c1)OCO2)N/N=C\c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C16H12Br2N2O4/c17-11-5-10(16(22)12(18)6-11)7-19-20-15(21)4-9-1-2-13-14(3-9)24-8-23-13/h1-3,5-7,22H,4,8H2,(H,20,21)/b19-7- |
| InChIKey | GJZRXNLPQHZUDY-GXHLCREISA-N |
| XLogP | 3.34 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.09 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|