C16H18N3O4+ — CID 136886967
N-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-2-pyridin-1-ium-1-ylacetamide (PubChem CID 136886967) has the molecular formula C16H18N3O4+ and a molecular weight of 316.34 g/mol. Its IUPAC name is N-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-2-pyridin-1-ium-1-ylacetamide.
| Compound Name | N-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-2-pyridin-1-ium-1-ylacetamide |
|---|---|
| PubChem CID | 136886967 |
| Molecular Formula | C16H18N3O4+ |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | N-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-2-pyridin-1-ium-1-ylacetamide |
| SMILES | COc1cc(/C=N\NC(=O)C[n+]2ccccc2)cc(OC)c1O |
| InChI | InChI=1S/C16H17N3O4/c1-22-13-8-12(9-14(23-2)16(13)21)10-17-18-15(20)11-19-6-4-3-5-7-19/h3-10H,11H2,1-2H3,(H-,17,18,20,21)/p+1 |
| InChIKey | QGUOWHIPWKHFRR-UHFFFAOYSA-O |
| XLogP | 0.85 |
| TPSA | 84.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|