C15H11Br2N3O2 — CID 3506666
N-(4-bromophenyl)-N'-[(2-bromophenyl)methylideneamino]oxamide (PubChem CID 3506666) has the molecular formula C15H11Br2N3O2 and a molecular weight of 425.08 g/mol. Its IUPAC name is N-(4-bromophenyl)-N'-[(2-bromophenyl)methylideneamino]oxamide.
| Compound Name | N-(4-bromophenyl)-N'-[(2-bromophenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 3506666 |
| Molecular Formula | C15H11Br2N3O2 |
| Molecular Weight | 425.08 g/mol |
| Exact Mass | 422.92 |
| IUPAC Name | N-(4-bromophenyl)-N'-[(2-bromophenyl)methylideneamino]oxamide |
| SMILES | O=C(NN=Cc1ccccc1Br)C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H11Br2N3O2/c16-11-5-7-12(8-6-11)19-14(21)15(22)20-18-9-10-3-1-2-4-13(10)17/h1-9H,(H,19,21)(H,20,22) |
| InChIKey | AXDODBUDVOTEFE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.08 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|