C20H19N3O3S — CID 99619776
N-(4-pyridin-4-yloxyphenyl)-N'-[(2R)-1-thiophen-2-ylpropan-2-yl]oxamide (PubChem CID 99619776) has the molecular formula C20H19N3O3S and a molecular weight of 381.46 g/mol. Its IUPAC name is N-(4-pyridin-4-yloxyphenyl)-N'-[(2R)-1-thiophen-2-ylpropan-2-yl]oxamide.
| Compound Name | N-(4-pyridin-4-yloxyphenyl)-N'-[(2R)-1-thiophen-2-ylpropan-2-yl]oxamide |
|---|---|
| PubChem CID | 99619776 |
| Molecular Formula | C20H19N3O3S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | N-(4-pyridin-4-yloxyphenyl)-N'-[(2R)-1-thiophen-2-ylpropan-2-yl]oxamide |
| SMILES | C[C@H](Cc1cccs1)NC(=O)C(=O)Nc1ccc(Oc2ccncc2)cc1 |
| InChI | InChI=1S/C20H19N3O3S/c1-14(13-18-3-2-12-27-18)22-19(24)20(25)23-15-4-6-16(7-5-15)26-17-8-10-21-11-9-17/h2-12,14H,13H2,1H3,(H,22,24)(H,23,25)/t14-/m1/s1 |
| InChIKey | YSTGQOBCPDXPPY-CQSZACIVSA-N |
| XLogP | 3.62 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|