C15H13F3N2O3S — CID 42929714
N-[1-oxo-1-[4-(trifluoromethoxy)anilino]propan-2-yl]thiophene-2-carboxamide (PubChem CID 42929714) has the molecular formula C15H13F3N2O3S and a molecular weight of 358.34 g/mol. Its IUPAC name is N-[1-oxo-1-[4-(trifluoromethoxy)anilino]propan-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-oxo-1-[4-(trifluoromethoxy)anilino]propan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 42929714 |
| Molecular Formula | C15H13F3N2O3S |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | N-[1-oxo-1-[4-(trifluoromethoxy)anilino]propan-2-yl]thiophene-2-carboxamide |
| SMILES | CC(NC(=O)c1cccs1)C(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H13F3N2O3S/c1-9(19-14(22)12-3-2-8-24-12)13(21)20-10-4-6-11(7-5-10)23-15(16,17)18/h2-9H,1H3,(H,19,22)(H,20,21) |
| InChIKey | FWYPLTDMBXERCX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |