C15H11Cl2NO3 — CID 2339712
[2-(4-methylphenyl)-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate (PubChem CID 2339712) has the molecular formula C15H11Cl2NO3 and a molecular weight of 324.16 g/mol. Its IUPAC name is [2-(4-methylphenyl)-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate.
| Compound Name | [2-(4-methylphenyl)-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 2339712 |
| Molecular Formula | C15H11Cl2NO3 |
| Molecular Weight | 324.16 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | [2-(4-methylphenyl)-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2nc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C15H11Cl2NO3/c1-9-2-4-10(5-3-9)12(19)8-21-15(20)14-11(16)6-7-13(17)18-14/h2-7H,8H2,1H3 |
| InChIKey | DPLVXRKBHXDZKJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.16 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|