C15H9Cl4NO4 — CID 7277838
[2-(4-methoxyphenyl)-2-oxoethyl] 3,4,5,6-tetrachloropyridine-2-carboxylate (PubChem CID 7277838) has the molecular formula C15H9Cl4NO4 and a molecular weight of 409.05 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-oxoethyl] 3,4,5,6-tetrachloropyridine-2-carboxylate.
| Compound Name | [2-(4-methoxyphenyl)-2-oxoethyl] 3,4,5,6-tetrachloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 7277838 |
| Molecular Formula | C15H9Cl4NO4 |
| Molecular Weight | 409.05 g/mol |
| Exact Mass | 406.93 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-oxoethyl] 3,4,5,6-tetrachloropyridine-2-carboxylate |
| SMILES | COc1ccc(C(=O)COC(=O)c2nc(Cl)c(Cl)c(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C15H9Cl4NO4/c1-23-8-4-2-7(3-5-8)9(21)6-24-15(22)13-11(17)10(16)12(18)14(19)20-13/h2-5H,6H2,1H3 |
| InChIKey | FWTGJTBCNVMYEE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.05 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|