C19H13Br2NO5 — CID 2379895
[2-(2,6-dibromo-4-methylanilino)-2-oxoethyl] 4-oxochromene-2-carboxylate (PubChem CID 2379895) has the molecular formula C19H13Br2NO5 and a molecular weight of 495.12 g/mol. Its IUPAC name is [2-(2,6-dibromo-4-methylanilino)-2-oxoethyl] 4-oxochromene-2-carboxylate.
| Compound Name | [2-(2,6-dibromo-4-methylanilino)-2-oxoethyl] 4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 2379895 |
| Molecular Formula | C19H13Br2NO5 |
| Molecular Weight | 495.12 g/mol |
| Exact Mass | 492.92 |
| IUPAC Name | [2-(2,6-dibromo-4-methylanilino)-2-oxoethyl] 4-oxochromene-2-carboxylate |
| SMILES | Cc1cc(Br)c(NC(=O)COC(=O)c2cc(=O)c3ccccc3o2)c(Br)c1 |
| InChI | InChI=1S/C19H13Br2NO5/c1-10-6-12(20)18(13(21)7-10)22-17(24)9-26-19(25)16-8-14(23)11-4-2-3-5-15(11)27-16/h2-8H,9H2,1H3,(H,22,24) |
| InChIKey | OZKNMEKMWYDCEI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.12 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |