C26H21NO7S — CID 3906298
[2-[(3-ethoxycarbonyl-5-methyl-4-phenylthiophen-2-yl)amino]-2-oxoethyl] 4-oxochromene-2-carboxylate (PubChem CID 3906298) has the molecular formula C26H21NO7S and a molecular weight of 491.52 g/mol. Its IUPAC name is [2-[(3-ethoxycarbonyl-5-methyl-4-phenylthiophen-2-yl)amino]-2-oxoethyl] 4-oxochromene-2-carboxylate.
| Compound Name | [2-[(3-ethoxycarbonyl-5-methyl-4-phenylthiophen-2-yl)amino]-2-oxoethyl] 4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 3906298 |
| Molecular Formula | C26H21NO7S |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | [2-[(3-ethoxycarbonyl-5-methyl-4-phenylthiophen-2-yl)amino]-2-oxoethyl] 4-oxochromene-2-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)COC(=O)c2cc(=O)c3ccccc3o2)sc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C26H21NO7S/c1-3-32-26(31)23-22(16-9-5-4-6-10-16)15(2)35-24(23)27-21(29)14-33-25(30)20-13-18(28)17-11-7-8-12-19(17)34-20/h4-13H,3,14H2,1-2H3,(H,27,29) |
| InChIKey | KDHKAWSOZFLESC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|