C27H28N2O3 — CID 36835148
N-[3-(diethylcarbamoyl)phenyl]-2-(3,4-dimethylbenzoyl)benzamide (PubChem CID 36835148) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is N-[3-(diethylcarbamoyl)phenyl]-2-(3,4-dimethylbenzoyl)benzamide.
| Compound Name | N-[3-(diethylcarbamoyl)phenyl]-2-(3,4-dimethylbenzoyl)benzamide |
|---|---|
| PubChem CID | 36835148 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | N-[3-(diethylcarbamoyl)phenyl]-2-(3,4-dimethylbenzoyl)benzamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)c2ccccc2C(=O)c2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C27H28N2O3/c1-5-29(6-2)27(32)21-10-9-11-22(17-21)28-26(31)24-13-8-7-12-23(24)25(30)20-15-14-18(3)19(4)16-20/h7-17H,5-6H2,1-4H3,(H,28,31) |
| InChIKey | BCRCKDMGXCQGNA-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |