C21H25N3O4 — CID 9289521
[2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl] 3-amino-4-methylbenzoate (PubChem CID 9289521) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is [2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl] 3-amino-4-methylbenzoate.
| Compound Name | [2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl] 3-amino-4-methylbenzoate |
|---|---|
| PubChem CID | 9289521 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | [2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl] 3-amino-4-methylbenzoate |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)COC(=O)c2ccc(C)c(N)c2)c1 |
| InChI | InChI=1S/C21H25N3O4/c1-4-24(5-2)20(26)15-7-6-8-17(11-15)23-19(25)13-28-21(27)16-10-9-14(3)18(22)12-16/h6-12H,4-5,13,22H2,1-3H3,(H,23,25) |
| InChIKey | NYXFPRABBVYBBZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|