C33H22N4O4 — CID 59499531
(3-ethynylphenyl) 3,5-bis[(4-ethynylphenyl)carbamoylamino]benzoate (PubChem CID 59499531) has the molecular formula C33H22N4O4 and a molecular weight of 538.56 g/mol. Its IUPAC name is (3-ethynylphenyl) 3,5-bis[(4-ethynylphenyl)carbamoylamino]benzoate.
| Compound Name | (3-ethynylphenyl) 3,5-bis[(4-ethynylphenyl)carbamoylamino]benzoate |
|---|---|
| PubChem CID | 59499531 |
| Molecular Formula | C33H22N4O4 |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | (3-ethynylphenyl) 3,5-bis[(4-ethynylphenyl)carbamoylamino]benzoate |
| SMILES | C#Cc1ccc(NC(=O)Nc2cc(NC(=O)Nc3ccc(C#C)cc3)cc(C(=O)Oc3cccc(C#C)c3)c2)cc1 |
| InChI | InChI=1S/C33H22N4O4/c1-4-22-10-14-26(15-11-22)34-32(39)36-28-19-25(31(38)41-30-9-7-8-24(6-3)18-30)20-29(21-28)37-33(40)35-27-16-12-23(5-2)13-17-27/h1-3,7-21H,(H2,34,36,39)(H2,35,37,40) |
| InChIKey | LRHUTZSCMRRJBT-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|