C17H14O3 — CID 59266279
(3,5-dimethylphenyl) (3-ethynylphenyl) carbonate (PubChem CID 59266279) has the molecular formula C17H14O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is (3,5-dimethylphenyl) (3-ethynylphenyl) carbonate.
| Compound Name | (3,5-dimethylphenyl) (3-ethynylphenyl) carbonate |
|---|---|
| PubChem CID | 59266279 |
| Molecular Formula | C17H14O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | (3,5-dimethylphenyl) (3-ethynylphenyl) carbonate |
| SMILES | C#Cc1cccc(OC(=O)Oc2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C17H14O3/c1-4-14-6-5-7-15(11-14)19-17(18)20-16-9-12(2)8-13(3)10-16/h1,5-11H,2-3H3 |
| InChIKey | USBZLBKLNNZVAM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|