C41H29N3O7 — CID 59499492
N-(3-ethynylphenyl)-3,5-bis[5-(3-hydroxy-3-methylbut-1-ynyl)-1,3-dioxoisoindol-2-yl]benzamide (PubChem CID 59499492) has the molecular formula C41H29N3O7 and a molecular weight of 675.70 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-3,5-bis[5-(3-hydroxy-3-methylbut-1-ynyl)-1,3-dioxoisoindol-2-yl]benzamide.
| Compound Name | N-(3-ethynylphenyl)-3,5-bis[5-(3-hydroxy-3-methylbut-1-ynyl)-1,3-dioxoisoindol-2-yl]benzamide |
|---|---|
| PubChem CID | 59499492 |
| Molecular Formula | C41H29N3O7 |
| Molecular Weight | 675.70 g/mol |
| Exact Mass | 675.20 |
| IUPAC Name | N-(3-ethynylphenyl)-3,5-bis[5-(3-hydroxy-3-methylbut-1-ynyl)-1,3-dioxoisoindol-2-yl]benzamide |
| SMILES | C#Cc1cccc(NC(=O)c2cc(N3C(=O)c4ccc(C#CC(C)(C)O)cc4C3=O)cc(N3C(=O)c4ccc(C#CC(C)(C)O)cc4C3=O)c2)c1 |
| InChI | InChI=1S/C41H29N3O7/c1-6-24-8-7-9-28(18-24)42-35(45)27-21-29(43-36(46)31-12-10-25(14-16-40(2,3)50)19-33(31)38(43)48)23-30(22-27)44-37(47)32-13-11-26(15-17-41(4,5)51)20-34(32)39(44)49/h1,7-13,18-23,50-51H,2-5H3,(H,42,45) |
| InChIKey | DXOARWMWTHQCPD-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.70 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|