C45H24N2O5 — CID 101056299
2-[3-(1,3-dioxoisoindol-2-yl)-5-[4-(2-phenylethynyl)benzoyl]phenyl]-5-(2-phenylethynyl)isoindole-1,3-dione (PubChem CID 101056299) has the molecular formula C45H24N2O5 and a molecular weight of 672.70 g/mol. Its IUPAC name is 2-[3-(1,3-dioxoisoindol-2-yl)-5-[4-(2-phenylethynyl)benzoyl]phenyl]-5-(2-phenylethynyl)isoindole-1,3-dione.
| Compound Name | 2-[3-(1,3-dioxoisoindol-2-yl)-5-[4-(2-phenylethynyl)benzoyl]phenyl]-5-(2-phenylethynyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 101056299 |
| Molecular Formula | C45H24N2O5 |
| Molecular Weight | 672.70 g/mol |
| Exact Mass | 672.17 |
| IUPAC Name | 2-[3-(1,3-dioxoisoindol-2-yl)-5-[4-(2-phenylethynyl)benzoyl]phenyl]-5-(2-phenylethynyl)isoindole-1,3-dione |
| SMILES | O=C(c1ccc(C#Cc2ccccc2)cc1)c1cc(N2C(=O)c3ccccc3C2=O)cc(N2C(=O)c3ccc(C#Cc4ccccc4)cc3C2=O)c1 |
| InChI | InChI=1S/C45H24N2O5/c48-41(33-22-19-31(20-23-33)16-15-29-9-3-1-4-10-29)34-26-35(46-42(49)37-13-7-8-14-38(37)43(46)50)28-36(27-34)47-44(51)39-24-21-32(25-40(39)45(47)52)18-17-30-11-5-2-6-12-30/h1-14,19-28H |
| InChIKey | REENHLGJXZKCOW-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.70 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|