C40H22N2O6 — CID 3095737
6,13-bis(3-benzoylphenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 3095737) has the molecular formula C40H22N2O6 and a molecular weight of 626.62 g/mol. Its IUPAC name is 6,13-bis(3-benzoylphenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6,13-bis(3-benzoylphenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 3095737 |
| Molecular Formula | C40H22N2O6 |
| Molecular Weight | 626.62 g/mol |
| Exact Mass | 626.15 |
| IUPAC Name | 6,13-bis(3-benzoylphenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | O=C(c1ccccc1)c1cccc(N2C(=O)c3ccc4c5c(ccc(c35)C2=O)C(=O)N(c2cccc(C(=O)c3ccccc3)c2)C4=O)c1 |
| InChI | InChI=1S/C40H22N2O6/c43-35(23-9-3-1-4-10-23)25-13-7-15-27(21-25)41-37(45)29-17-19-31-34-32(20-18-30(33(29)34)38(41)46)40(48)42(39(31)47)28-16-8-14-26(22-28)36(44)24-11-5-2-6-12-24/h1-22H |
| InChIKey | NHFQRAAOAUPFGN-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.62 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|