C33H18N2O15S3 — CID 86227958
4-[2-sulfo-4-[3-(5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)benzoyl]phenoxy]benzene-1,3-disulfonic acid (PubChem CID 86227958) has the molecular formula C33H18N2O15S3 and a molecular weight of 778.71 g/mol. Its IUPAC name is 4-[2-sulfo-4-[3-(5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)benzoyl]phenoxy]benzene-1,3-disulfonic acid.
| Compound Name | 4-[2-sulfo-4-[3-(5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)benzoyl]phenoxy]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 86227958 |
| Molecular Formula | C33H18N2O15S3 |
| Molecular Weight | 778.71 g/mol |
| Exact Mass | 777.99 |
| IUPAC Name | 4-[2-sulfo-4-[3-(5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)benzoyl]phenoxy]benzene-1,3-disulfonic acid |
| SMILES | O=C(c1cccc(N2C(=O)c3ccc4c5c(ccc(c35)C2=O)C(=O)NC4=O)c1)c1ccc(Oc2ccc(S(=O)(=O)O)cc2S(=O)(=O)O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C33H18N2O15S3/c36-29(16-4-10-23(25(13-16)52(44,45)46)50-24-11-5-18(51(41,42)43)14-26(24)53(47,48)49)15-2-1-3-17(12-15)35-32(39)21-8-6-19-27-20(31(38)34-30(19)37)7-9-22(28(21)27)33(35)40/h1-14H,(H,34,37,38)(H,41,42,43)(H,44,45,46)(H,47,48,49) |
| InChIKey | QJOXRTFGKROBQK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 272.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.71 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|