C38H26N2O6 — CID 3884428
4,10-bis(3-benzoylphenyl)-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone (PubChem CID 3884428) has the molecular formula C38H26N2O6 and a molecular weight of 606.63 g/mol. Its IUPAC name is 4,10-bis(3-benzoylphenyl)-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone.
| Compound Name | 4,10-bis(3-benzoylphenyl)-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone |
|---|---|
| PubChem CID | 3884428 |
| Molecular Formula | C38H26N2O6 |
| Molecular Weight | 606.63 g/mol |
| Exact Mass | 606.18 |
| IUPAC Name | 4,10-bis(3-benzoylphenyl)-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone |
| SMILES | O=C(c1ccccc1)c1cccc(N2C(=O)C3C4C=CC(C3C2=O)C2C(=O)N(c3cccc(C(=O)c5ccccc5)c3)C(=O)C42)c1 |
| InChI | InChI=1S/C38H26N2O6/c41-33(21-9-3-1-4-10-21)23-13-7-15-25(19-23)39-35(43)29-27-17-18-28(30(29)36(39)44)32-31(27)37(45)40(38(32)46)26-16-8-14-24(20-26)34(42)22-11-5-2-6-12-22/h1-20,27-32H |
| InChIKey | XDQQGNXZUDBWGW-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.63 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|