C24H19NO6 — CID 59499593
5-[5-(2-cyclohexylethynyl)-1,3-dioxoisoindol-2-yl]benzene-1,3-dicarboxylic acid (PubChem CID 59499593) has the molecular formula C24H19NO6 and a molecular weight of 417.42 g/mol. Its IUPAC name is 5-[5-(2-cyclohexylethynyl)-1,3-dioxoisoindol-2-yl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[5-(2-cyclohexylethynyl)-1,3-dioxoisoindol-2-yl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 59499593 |
| Molecular Formula | C24H19NO6 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 5-[5-(2-cyclohexylethynyl)-1,3-dioxoisoindol-2-yl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)cc(N2C(=O)c3ccc(C#CC4CCCCC4)cc3C2=O)c1 |
| InChI | InChI=1S/C24H19NO6/c26-21-19-9-8-15(7-6-14-4-2-1-3-5-14)10-20(19)22(27)25(21)18-12-16(23(28)29)11-17(13-18)24(30)31/h8-14H,1-5H2,(H,28,29)(H,30,31) |
| InChIKey | XZAMTMDPNJVJNG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|