C24H18N2O3 — CID 159881016
benzene;N-[4-(5-ethynyl-1,3-dioxoisoindol-2-yl)phenyl]acetamide (PubChem CID 159881016) has the molecular formula C24H18N2O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is benzene;N-[4-(5-ethynyl-1,3-dioxoisoindol-2-yl)phenyl]acetamide.
| Compound Name | benzene;N-[4-(5-ethynyl-1,3-dioxoisoindol-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 159881016 |
| Molecular Formula | C24H18N2O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | benzene;N-[4-(5-ethynyl-1,3-dioxoisoindol-2-yl)phenyl]acetamide |
| SMILES | C#Cc1ccc2c(c1)C(=O)N(c1ccc(NC(C)=O)cc1)C2=O.c1ccccc1 |
| InChI | InChI=1S/C18H12N2O3.C6H6/c1-3-12-4-9-15-16(10-12)18(23)20(17(15)22)14-7-5-13(6-8-14)19-11(2)21;1-2-4-6-5-3-1/h1,4-10H,2H3,(H,19,21);1-6H |
| InChIKey | NTNHMYPENIAOLO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|