C45H24N2O4 — CID 155220077
5-ethynyl-2-[4-[9-[4-(5-ethynyl-1,3-dioxoisoindol-2-yl)phenyl]fluoren-9-yl]phenyl]isoindole-1,3-dione (PubChem CID 155220077) has the molecular formula C45H24N2O4 and a molecular weight of 656.70 g/mol. Its IUPAC name is 5-ethynyl-2-[4-[9-[4-(5-ethynyl-1,3-dioxoisoindol-2-yl)phenyl]fluoren-9-yl]phenyl]isoindole-1,3-dione.
| Compound Name | 5-ethynyl-2-[4-[9-[4-(5-ethynyl-1,3-dioxoisoindol-2-yl)phenyl]fluoren-9-yl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 155220077 |
| Molecular Formula | C45H24N2O4 |
| Molecular Weight | 656.70 g/mol |
| Exact Mass | 656.17 |
| IUPAC Name | 5-ethynyl-2-[4-[9-[4-(5-ethynyl-1,3-dioxoisoindol-2-yl)phenyl]fluoren-9-yl]phenyl]isoindole-1,3-dione |
| SMILES | C#Cc1ccc2c(c1)C(=O)N(c1ccc(C3(c4ccc(N5C(=O)c6ccc(C#C)cc6C5=O)cc4)c4ccccc4-c4ccccc43)cc1)C2=O |
| InChI | InChI=1S/C45H24N2O4/c1-3-27-13-23-35-37(25-27)43(50)46(41(35)48)31-19-15-29(16-20-31)45(39-11-7-5-9-33(39)34-10-6-8-12-40(34)45)30-17-21-32(22-18-30)47-42(49)36-24-14-28(4-2)26-38(36)44(47)51/h1-2,5-26H |
| InChIKey | UAHIFCMAIKGLTR-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.70 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|